C12H10FN3O6 — CID 15484802
ethyl 2-(7-fluoro-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)acetate (PubChem CID 15484802) has the molecular formula C12H10FN3O6 and a molecular weight of 311.23 g/mol. Its IUPAC name is ethyl 2-(7-fluoro-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)acetate.
| Compound Name | ethyl 2-(7-fluoro-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)acetate |
|---|---|
| PubChem CID | 15484802 |
| Molecular Formula | C12H10FN3O6 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | ethyl 2-(7-fluoro-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)acetate |
| SMILES | CCOC(=O)Cn1c(=O)c(=O)[nH]c2cc([N+](=O)[O-])c(F)cc21 |
| InChI | InChI=1S/C12H10FN3O6/c1-2-22-10(17)5-15-9-3-6(13)8(16(20)21)4-7(9)14-11(18)12(15)19/h3-4H,2,5H2,1H3,(H,14,18) |
| InChIKey | AHAHLYMAMIRLMQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|