C15H15N5O7 — CID 19101568
2-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl acetate;hydrate (PubChem CID 19101568) has the molecular formula C15H15N5O7 and a molecular weight of 377.31 g/mol. Its IUPAC name is 2-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl acetate;hydrate.
| Compound Name | 2-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl acetate;hydrate |
|---|---|
| PubChem CID | 19101568 |
| Molecular Formula | C15H15N5O7 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)ethyl acetate;hydrate |
| SMILES | CC(=O)OCCn1c(=O)c(=O)[nH]c2cc([N+](=O)[O-])c(-n3ccnc3)cc21.O |
| InChI | InChI=1S/C15H13N5O6.H2O/c1-9(21)26-5-4-19-11-7-12(18-3-2-16-8-18)13(20(24)25)6-10(11)17-14(22)15(19)23;/h2-3,6-8H,4-5H2,1H3,(H,17,22);1H2 |
| InChIKey | ZTKDICBDZXYQFF-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 173.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|