C16H19N5O8S — CID 70299055
6-imidazol-1-yl-7-nitro-4-pentyl-1H-quinoxaline-2,3-dione;sulfuric acid (PubChem CID 70299055) has the molecular formula C16H19N5O8S and a molecular weight of 441.42 g/mol. Its IUPAC name is 6-imidazol-1-yl-7-nitro-4-pentyl-1H-quinoxaline-2,3-dione;sulfuric acid.
| Compound Name | 6-imidazol-1-yl-7-nitro-4-pentyl-1H-quinoxaline-2,3-dione;sulfuric acid |
|---|---|
| PubChem CID | 70299055 |
| Molecular Formula | C16H19N5O8S |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 6-imidazol-1-yl-7-nitro-4-pentyl-1H-quinoxaline-2,3-dione;sulfuric acid |
| SMILES | CCCCCn1c(=O)c(=O)[nH]c2cc([N+](=O)[O-])c(-n3ccnc3)cc21.O=S(=O)(O)O |
| InChI | InChI=1S/C16H17N5O4.H2O4S/c1-2-3-4-6-20-12-9-13(19-7-5-17-10-19)14(21(24)25)8-11(12)18-15(22)16(20)23;1-5(2,3)4/h5,7-10H,2-4,6H2,1H3,(H,18,22);(H2,1,2,3,4) |
| InChIKey | CCEFSGBNTCIHBC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 190.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|