C13H12N5O7P — CID 67558950
2-(6-imidazol-1-yl-7-nitro-2,3-dioxo-4H-quinoxalin-1-yl)ethylphosphonic acid (PubChem CID 67558950) has the molecular formula C13H12N5O7P and a molecular weight of 381.24 g/mol. Its IUPAC name is 2-(6-imidazol-1-yl-7-nitro-2,3-dioxo-4H-quinoxalin-1-yl)ethylphosphonic acid.
| Compound Name | 2-(6-imidazol-1-yl-7-nitro-2,3-dioxo-4H-quinoxalin-1-yl)ethylphosphonic acid |
|---|---|
| PubChem CID | 67558950 |
| Molecular Formula | C13H12N5O7P |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-(6-imidazol-1-yl-7-nitro-2,3-dioxo-4H-quinoxalin-1-yl)ethylphosphonic acid |
| SMILES | O=c1[nH]c2cc(-n3ccnc3)c([N+](=O)[O-])cc2n(CCP(=O)(O)O)c1=O |
| InChI | InChI=1S/C13H12N5O7P/c19-12-13(20)17(3-4-26(23,24)25)9-6-11(18(21)22)10(5-8(9)15-12)16-2-1-14-7-16/h1-2,5-7H,3-4H2,(H,15,19)(H2,23,24,25) |
| InChIKey | CHAMCMXPSBMHOM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 173.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|