C16H17N5O4 — CID 10641103
6-imidazol-1-yl-4-(3-methylbutyl)-7-nitro-1H-quinoxaline-2,3-dione (PubChem CID 10641103) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 6-imidazol-1-yl-4-(3-methylbutyl)-7-nitro-1H-quinoxaline-2,3-dione.
| Compound Name | 6-imidazol-1-yl-4-(3-methylbutyl)-7-nitro-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10641103 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 6-imidazol-1-yl-4-(3-methylbutyl)-7-nitro-1H-quinoxaline-2,3-dione |
| SMILES | CC(C)CCn1c(=O)c(=O)[nH]c2cc([N+](=O)[O-])c(-n3ccnc3)cc21 |
| InChI | InChI=1S/C16H17N5O4/c1-10(2)3-5-20-12-8-13(19-6-4-17-9-19)14(21(24)25)7-11(12)18-15(22)16(20)23/h4,6-10H,3,5H2,1-2H3,(H,18,22) |
| InChIKey | OGGSXXJPLPXRSP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|