C15H17N6NaO7S — CID 173295954
sodium;hydride;4-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)butylsulfamic acid (PubChem CID 173295954) has the molecular formula C15H17N6NaO7S and a molecular weight of 448.39 g/mol. Its IUPAC name is sodium;hydride;4-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)butylsulfamic acid.
| Compound Name | sodium;hydride;4-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)butylsulfamic acid |
|---|---|
| PubChem CID | 173295954 |
| Molecular Formula | C15H17N6NaO7S |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | sodium;hydride;4-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)butylsulfamic acid |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])c(-n3ccnc3)cc2n(CCCCNS(=O)(=O)O)c1=O.[H-].[Na+] |
| InChI | InChI=1S/C15H16N6O7S.Na.H/c22-14-15(23)20(5-2-1-3-17-29(26,27)28)11-8-12(19-6-4-16-9-19)13(21(24)25)7-10(11)18-14;;/h4,6-9,17H,1-3,5H2,(H,18,22)(H,26,27,28);;/q;+1;-1 |
| InChIKey | GJVDEDDVDYQDPN-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 182.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|