C17H17N5O6 — CID 170341283
ethyl 4-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)butanoate (PubChem CID 170341283) has the molecular formula C17H17N5O6 and a molecular weight of 387.35 g/mol. Its IUPAC name is ethyl 4-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)butanoate.
| Compound Name | ethyl 4-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)butanoate |
|---|---|
| PubChem CID | 170341283 |
| Molecular Formula | C17H17N5O6 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | ethyl 4-(7-imidazol-1-yl-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl)butanoate |
| SMILES | CCOC(=O)CCCn1c(=O)c(=O)[nH]c2cc([N+](=O)[O-])c(-n3ccnc3)cc21 |
| InChI | InChI=1S/C17H17N5O6/c1-2-28-15(23)4-3-6-21-12-9-13(20-7-5-18-10-20)14(22(26)27)8-11(12)19-16(24)17(21)25/h5,7-10H,2-4,6H2,1H3,(H,19,24) |
| InChIKey | RPBOJSZDVVGRPQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 142.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|