C16H16N4O6S — CID 18695425
ethyl 2-(7-imidazol-1-yl-6-methylsulfonyl-2,3-dioxo-4H-quinoxalin-1-yl)acetate (PubChem CID 18695425) has the molecular formula C16H16N4O6S and a molecular weight of 392.39 g/mol. Its IUPAC name is ethyl 2-(7-imidazol-1-yl-6-methylsulfonyl-2,3-dioxo-4H-quinoxalin-1-yl)acetate.
| Compound Name | ethyl 2-(7-imidazol-1-yl-6-methylsulfonyl-2,3-dioxo-4H-quinoxalin-1-yl)acetate |
|---|---|
| PubChem CID | 18695425 |
| Molecular Formula | C16H16N4O6S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | ethyl 2-(7-imidazol-1-yl-6-methylsulfonyl-2,3-dioxo-4H-quinoxalin-1-yl)acetate |
| SMILES | CCOC(=O)Cn1c(=O)c(=O)[nH]c2cc(S(C)(=O)=O)c(-n3ccnc3)cc21 |
| InChI | InChI=1S/C16H16N4O6S/c1-3-26-14(21)8-20-11-7-12(19-5-4-17-9-19)13(27(2,24)25)6-10(11)18-15(22)16(20)23/h4-7,9H,3,8H2,1-2H3,(H,18,22) |
| InChIKey | CCNFNMCLTWPNCT-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|