C14H16N6O4 — CID 630402
ethyl 2-(8-imidazol-1-yl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 630402) has the molecular formula C14H16N6O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is ethyl 2-(8-imidazol-1-yl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
| Compound Name | ethyl 2-(8-imidazol-1-yl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
|---|---|
| PubChem CID | 630402 |
| Molecular Formula | C14H16N6O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | ethyl 2-(8-imidazol-1-yl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | CCOC(=O)Cn1c(-n2ccnc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H16N6O4/c1-4-24-9(21)7-20-10-11(16-13(20)19-6-5-15-8-19)17(2)14(23)18(3)12(10)22/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | PLYYNMDCTDGKNN-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 105.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |