C11H13ClN4O4 — CID 703754
ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 703754) has the molecular formula C11H13ClN4O4 and a molecular weight of 300.70 g/mol. Its IUPAC name is ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
| Compound Name | ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
|---|---|
| PubChem CID | 703754 |
| Molecular Formula | C11H13ClN4O4 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | CCOC(=O)Cn1c(Cl)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C11H13ClN4O4/c1-4-20-6(17)5-16-7-8(13-10(16)12)14(2)11(19)15(3)9(7)18/h4-5H2,1-3H3 |
| InChIKey | JZZKOLZPXLCWMA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |