C12H17ClN4O2 — CID 3239845
8-chloro-1,3-dimethyl-7-(3-methylbutyl)purine-2,6-dione (PubChem CID 3239845) has the molecular formula C12H17ClN4O2 and a molecular weight of 284.75 g/mol. Its IUPAC name is 8-chloro-1,3-dimethyl-7-(3-methylbutyl)purine-2,6-dione.
| Compound Name | 8-chloro-1,3-dimethyl-7-(3-methylbutyl)purine-2,6-dione |
|---|---|
| PubChem CID | 3239845 |
| Molecular Formula | C12H17ClN4O2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 8-chloro-1,3-dimethyl-7-(3-methylbutyl)purine-2,6-dione |
| SMILES | CC(C)CCn1c(Cl)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C12H17ClN4O2/c1-7(2)5-6-17-8-9(14-11(17)13)15(3)12(19)16(4)10(8)18/h7H,5-6H2,1-4H3 |
| InChIKey | KICUYHNUVXFUQT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |