C17H26ClN5O3 — CID 9201830
2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(2R)-octan-2-yl]acetamide (PubChem CID 9201830) has the molecular formula C17H26ClN5O3 and a molecular weight of 383.88 g/mol. Its IUPAC name is 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(2R)-octan-2-yl]acetamide.
| Compound Name | 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(2R)-octan-2-yl]acetamide |
|---|---|
| PubChem CID | 9201830 |
| Molecular Formula | C17H26ClN5O3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(2R)-octan-2-yl]acetamide |
| SMILES | CCCCCC[C@@H](C)NC(=O)Cn1c(Cl)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H26ClN5O3/c1-5-6-7-8-9-11(2)19-12(24)10-23-13-14(20-16(23)18)21(3)17(26)22(4)15(13)25/h11H,5-10H2,1-4H3,(H,19,24)/t11-/m1/s1 |
| InChIKey | HUDBXAZIRIXJEY-LLVKDONJSA-N |
| XLogP | 1.56 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|