C16H25ClN5O3S+ — CID 54322270
[2-[(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)methylsulfanyl]-2-oxoethyl]-triethylazanium (PubChem CID 54322270) has the molecular formula C16H25ClN5O3S+ and a molecular weight of 402.93 g/mol. Its IUPAC name is [2-[(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)methylsulfanyl]-2-oxoethyl]-triethylazanium.
| Compound Name | [2-[(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)methylsulfanyl]-2-oxoethyl]-triethylazanium |
|---|---|
| PubChem CID | 54322270 |
| Molecular Formula | C16H25ClN5O3S+ |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [2-[(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)methylsulfanyl]-2-oxoethyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC(=O)SCn1c(Cl)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H25ClN5O3S/c1-6-22(7-2,8-3)9-11(23)26-10-21-12-13(18-15(21)17)19(4)16(25)20(5)14(12)24/h6-10H2,1-5H3/q+1 |
| InChIKey | LYONZHAMEOUFIP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|