C11H11ClN4O2 — CID 22029437
7-but-2-ynyl-8-chloro-1,3-dimethylpurine-2,6-dione (PubChem CID 22029437) has the molecular formula C11H11ClN4O2 and a molecular weight of 266.69 g/mol. Its IUPAC name is 7-but-2-ynyl-8-chloro-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-but-2-ynyl-8-chloro-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 22029437 |
| Molecular Formula | C11H11ClN4O2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 7-but-2-ynyl-8-chloro-1,3-dimethylpurine-2,6-dione |
| SMILES | CC#CCn1c(Cl)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C11H11ClN4O2/c1-4-5-6-16-7-8(13-10(16)12)14(2)11(18)15(3)9(7)17/h6H2,1-3H3 |
| InChIKey | KNUCUUGOPBGLBO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|