C20H19ClN8O4 — CID 161224222
7-but-2-ynyl-8-chloro-3-methylpurine-2,6-dione;7-but-2-ynyl-3-methylpurine-2,6-dione (PubChem CID 161224222) has the molecular formula C20H19ClN8O4 and a molecular weight of 470.88 g/mol. Its IUPAC name is 7-but-2-ynyl-8-chloro-3-methylpurine-2,6-dione;7-but-2-ynyl-3-methylpurine-2,6-dione.
| Compound Name | 7-but-2-ynyl-8-chloro-3-methylpurine-2,6-dione;7-but-2-ynyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 161224222 |
| Molecular Formula | C20H19ClN8O4 |
| Molecular Weight | 470.88 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 7-but-2-ynyl-8-chloro-3-methylpurine-2,6-dione;7-but-2-ynyl-3-methylpurine-2,6-dione |
| SMILES | CC#CCn1c(Cl)nc2c1c(=O)[nH]c(=O)n2C.CC#CCn1cnc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C10H9ClN4O2.C10H10N4O2/c1-3-4-5-15-6-7(12-9(15)11)14(2)10(17)13-8(6)16;1-3-4-5-14-6-11-8-7(14)9(15)12-10(16)13(8)2/h5H2,1-2H3,(H,13,16,17);6H,5H2,1-2H3,(H,12,15,16) |
| InChIKey | UXXHMIKYLBSHDN-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.88 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|