C16H20N4O6 — CID 171898424
ethyl 4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)-3,4-dihydroxybutanoate (PubChem CID 171898424) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is ethyl 4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171898424 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | ethyl 4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)-3,4-dihydroxybutanoate |
| SMILES | CC#CCn1c(C(O)C(O)CC(=O)OCC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C16H20N4O6/c1-4-6-7-20-11-13(19(3)16(25)18-15(11)24)17-14(20)12(23)9(21)8-10(22)26-5-2/h9,12,21,23H,5,7-8H2,1-3H3,(H,18,24,25) |
| InChIKey | UUQMITQZQBMKTB-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|