C14H20N6O4 — CID 132585677
ethyl 2-(3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)acetate (PubChem CID 132585677) has the molecular formula C14H20N6O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is ethyl 2-(3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)acetate.
| Compound Name | ethyl 2-(3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)acetate |
|---|---|
| PubChem CID | 132585677 |
| Molecular Formula | C14H20N6O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | ethyl 2-(3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)acetate |
| SMILES | CCOC(=O)Cn1c(N2CCNCC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H20N6O4/c1-3-24-9(21)8-20-10-11(18(2)14(23)17-12(10)22)16-13(20)19-6-4-15-5-7-19/h15H,3-8H2,1-2H3,(H,17,22,23) |
| InChIKey | RKSRNMXZBILHGB-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |