C12H17N7O3 — CID 4278932
2-(3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)acetamide (PubChem CID 4278932) has the molecular formula C12H17N7O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-(3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)acetamide.
| Compound Name | 2-(3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)acetamide |
|---|---|
| PubChem CID | 4278932 |
| Molecular Formula | C12H17N7O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-(3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-7-yl)acetamide |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCNCC1)n2CC(N)=O |
| InChI | InChI=1S/C12H17N7O3/c1-17-9-8(10(21)16-12(17)22)19(6-7(13)20)11(15-9)18-4-2-14-3-5-18/h14H,2-6H2,1H3,(H2,13,20)(H,16,21,22) |
| InChIKey | DAUCXVQQMYXRQD-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |