C16H23N5O2 — CID 741827
8-(azepan-1-yl)-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione (PubChem CID 741827) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 8-(azepan-1-yl)-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione.
| Compound Name | 8-(azepan-1-yl)-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione |
|---|---|
| PubChem CID | 741827 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 8-(azepan-1-yl)-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione |
| SMILES | C=C(C)Cn1c(N2CCCCCC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C16H23N5O2/c1-11(2)10-21-12-13(19(3)16(23)18-14(12)22)17-15(21)20-8-6-4-5-7-9-20/h1,4-10H2,2-3H3,(H,18,22,23) |
| InChIKey | PGZWZZCLTUEWOL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|