C20H33N6O2+ — CID 6965336
7-[2-(azepan-1-ium-1-yl)ethyl]-8-(azepan-1-yl)-3-methylpurine-2,6-dione (PubChem CID 6965336) has the molecular formula C20H33N6O2+ and a molecular weight of 389.52 g/mol. Its IUPAC name is 7-[2-(azepan-1-ium-1-yl)ethyl]-8-(azepan-1-yl)-3-methylpurine-2,6-dione.
| Compound Name | 7-[2-(azepan-1-ium-1-yl)ethyl]-8-(azepan-1-yl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 6965336 |
| Molecular Formula | C20H33N6O2+ |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 7-[2-(azepan-1-ium-1-yl)ethyl]-8-(azepan-1-yl)-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCCCCC1)n2CC[NH+]1CCCCCC1 |
| InChI | InChI=1S/C20H32N6O2/c1-23-17-16(18(27)22-20(23)28)26(15-14-24-10-6-2-3-7-11-24)19(21-17)25-12-8-4-5-9-13-25/h2-15H2,1H3,(H,22,27,28)/p+1 |
| InChIKey | BUGSHYCRAVCTKK-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |