C13H21N7O2 — CID 5128003
7-(2-hydrazinylethyl)-3-methyl-8-piperidin-1-ylpurine-2,6-dione (PubChem CID 5128003) has the molecular formula C13H21N7O2 and a molecular weight of 307.36 g/mol. Its IUPAC name is 7-(2-hydrazinylethyl)-3-methyl-8-piperidin-1-ylpurine-2,6-dione.
| Compound Name | 7-(2-hydrazinylethyl)-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 5128003 |
| Molecular Formula | C13H21N7O2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 7-(2-hydrazinylethyl)-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCCCC1)n2CCNN |
| InChI | InChI=1S/C13H21N7O2/c1-18-10-9(11(21)17-13(18)22)20(8-5-15-14)12(16-10)19-6-3-2-4-7-19/h15H,2-8,14H2,1H3,(H,17,21,22) |
| InChIKey | JOTUPEINRIGGTA-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|