C26H36N10O5 — CID 3920803
3-methyl-7-[2-[2-(3-methyl-2,6-dioxo-8-piperidin-1-ylpurin-7-yl)ethoxy]ethyl]-8-piperidin-1-ylpurine-2,6-dione (PubChem CID 3920803) has the molecular formula C26H36N10O5 and a molecular weight of 568.64 g/mol. Its IUPAC name is 3-methyl-7-[2-[2-(3-methyl-2,6-dioxo-8-piperidin-1-ylpurin-7-yl)ethoxy]ethyl]-8-piperidin-1-ylpurine-2,6-dione.
| Compound Name | 3-methyl-7-[2-[2-(3-methyl-2,6-dioxo-8-piperidin-1-ylpurin-7-yl)ethoxy]ethyl]-8-piperidin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 3920803 |
| Molecular Formula | C26H36N10O5 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 3-methyl-7-[2-[2-(3-methyl-2,6-dioxo-8-piperidin-1-ylpurin-7-yl)ethoxy]ethyl]-8-piperidin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCCCC1)n2CCOCCn1c(N2CCCCC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C26H36N10O5/c1-31-19-17(21(37)29-25(31)39)35(23(27-19)33-9-5-3-6-10-33)13-15-41-16-14-36-18-20(32(2)26(40)30-22(18)38)28-24(36)34-11-7-4-8-12-34/h3-16H2,1-2H3,(H,29,37,39)(H,30,38,40) |
| InChIKey | FSRGAHNODFYZFD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 161.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|