C18H28N6O4 — CID 66491448
8-(4-butanoylpiperazin-1-yl)-7-(2-ethoxyethyl)-3-methylpurine-2,6-dione (PubChem CID 66491448) has the molecular formula C18H28N6O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 8-(4-butanoylpiperazin-1-yl)-7-(2-ethoxyethyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-(4-butanoylpiperazin-1-yl)-7-(2-ethoxyethyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 66491448 |
| Molecular Formula | C18H28N6O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 8-(4-butanoylpiperazin-1-yl)-7-(2-ethoxyethyl)-3-methylpurine-2,6-dione |
| SMILES | CCCC(=O)N1CCN(c2nc3c(c(=O)[nH]c(=O)n3C)n2CCOCC)CC1 |
| InChI | InChI=1S/C18H28N6O4/c1-4-6-13(25)22-7-9-23(10-8-22)17-19-15-14(24(17)11-12-28-5-2)16(26)20-18(27)21(15)3/h4-12H2,1-3H3,(H,20,26,27) |
| InChIKey | ZILFSBXWNMBGJJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|