C18H28N6O3 — CID 66491456
8-(4-acetylpiperazin-1-yl)-7-hexyl-3-methylpurine-2,6-dione (PubChem CID 66491456) has the molecular formula C18H28N6O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 8-(4-acetylpiperazin-1-yl)-7-hexyl-3-methylpurine-2,6-dione.
| Compound Name | 8-(4-acetylpiperazin-1-yl)-7-hexyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 66491456 |
| Molecular Formula | C18H28N6O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 8-(4-acetylpiperazin-1-yl)-7-hexyl-3-methylpurine-2,6-dione |
| SMILES | CCCCCCn1c(N2CCN(C(C)=O)CC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C18H28N6O3/c1-4-5-6-7-8-24-14-15(21(3)18(27)20-16(14)26)19-17(24)23-11-9-22(10-12-23)13(2)25/h4-12H2,1-3H3,(H,20,26,27) |
| InChIKey | LMTPEVWPAYKESK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|