C23H30Cl2N6O2 — CID 16618705
8-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-7-hexyl-3-methylpurine-2,6-dione (PubChem CID 16618705) has the molecular formula C23H30Cl2N6O2 and a molecular weight of 493.44 g/mol. Its IUPAC name is 8-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-7-hexyl-3-methylpurine-2,6-dione.
| Compound Name | 8-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-7-hexyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 16618705 |
| Molecular Formula | C23H30Cl2N6O2 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 8-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-7-hexyl-3-methylpurine-2,6-dione |
| SMILES | CCCCCCn1c(N2CCN(Cc3ccc(Cl)c(Cl)c3)CC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C23H30Cl2N6O2/c1-3-4-5-6-9-31-19-20(28(2)23(33)27-21(19)32)26-22(31)30-12-10-29(11-13-30)15-16-7-8-17(24)18(25)14-16/h7-8,14H,3-6,9-13,15H2,1-2H3,(H,27,32,33) |
| InChIKey | IUZLIJJIBPKXMY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|