C17H27N5O2 — CID 3996426
3-methyl-8-(3-methylpiperidin-1-yl)-7-pentylpurine-2,6-dione (PubChem CID 3996426) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 3-methyl-8-(3-methylpiperidin-1-yl)-7-pentylpurine-2,6-dione.
| Compound Name | 3-methyl-8-(3-methylpiperidin-1-yl)-7-pentylpurine-2,6-dione |
|---|---|
| PubChem CID | 3996426 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 3-methyl-8-(3-methylpiperidin-1-yl)-7-pentylpurine-2,6-dione |
| SMILES | CCCCCn1c(N2CCCC(C)C2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C17H27N5O2/c1-4-5-6-10-22-13-14(20(3)17(24)19-15(13)23)18-16(22)21-9-7-8-12(2)11-21/h12H,4-11H2,1-3H3,(H,19,23,24) |
| InChIKey | CKTNDQOQWZCGGJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|