C15H25N6O2+ — CID 6999623
3-methyl-7-pentyl-8-piperazin-4-ium-1-ylpurine-2,6-dione (PubChem CID 6999623) has the molecular formula C15H25N6O2+ and a molecular weight of 321.41 g/mol. Its IUPAC name is 3-methyl-7-pentyl-8-piperazin-4-ium-1-ylpurine-2,6-dione.
| Compound Name | 3-methyl-7-pentyl-8-piperazin-4-ium-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 6999623 |
| Molecular Formula | C15H25N6O2+ |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 3-methyl-7-pentyl-8-piperazin-4-ium-1-ylpurine-2,6-dione |
| SMILES | CCCCCn1c(N2CC[NH2+]CC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C15H24N6O2/c1-3-4-5-8-21-11-12(19(2)15(23)18-13(11)22)17-14(21)20-9-6-16-7-10-20/h16H,3-10H2,1-2H3,(H,18,22,23)/p+1 |
| InChIKey | OUSLXRFGRYFMIR-UHFFFAOYSA-O |
| XLogP | -1.00 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|