C16H22N6O3 — CID 66491458
8-(4-acetylpiperazin-1-yl)-7-[(E)-but-2-enyl]-3-methylpurine-2,6-dione (PubChem CID 66491458) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 8-(4-acetylpiperazin-1-yl)-7-[(E)-but-2-enyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(4-acetylpiperazin-1-yl)-7-[(E)-but-2-enyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 66491458 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 8-(4-acetylpiperazin-1-yl)-7-[(E)-but-2-enyl]-3-methylpurine-2,6-dione |
| SMILES | C/C=C/Cn1c(N2CCN(C(C)=O)CC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C16H22N6O3/c1-4-5-6-22-12-13(19(3)16(25)18-14(12)24)17-15(22)21-9-7-20(8-10-21)11(2)23/h4-5H,6-10H2,1-3H3,(H,18,24,25)/b5-4+ |
| InChIKey | ZTTJHXXFCSRSEP-SNAWJCMRSA-N |
| XLogP | -0.33 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|