C21H25BrN6O3 — CID 66491701
7-[(4-bromophenyl)methyl]-8-(4-butanoylpiperazin-1-yl)-3-methylpurine-2,6-dione (PubChem CID 66491701) has the molecular formula C21H25BrN6O3 and a molecular weight of 489.37 g/mol. Its IUPAC name is 7-[(4-bromophenyl)methyl]-8-(4-butanoylpiperazin-1-yl)-3-methylpurine-2,6-dione.
| Compound Name | 7-[(4-bromophenyl)methyl]-8-(4-butanoylpiperazin-1-yl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 66491701 |
| Molecular Formula | C21H25BrN6O3 |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 7-[(4-bromophenyl)methyl]-8-(4-butanoylpiperazin-1-yl)-3-methylpurine-2,6-dione |
| SMILES | CCCC(=O)N1CCN(c2nc3c(c(=O)[nH]c(=O)n3C)n2Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C21H25BrN6O3/c1-3-4-16(29)26-9-11-27(12-10-26)20-23-18-17(19(30)24-21(31)25(18)2)28(20)13-14-5-7-15(22)8-6-14/h5-8H,3-4,9-13H2,1-2H3,(H,24,30,31) |
| InChIKey | CPXPPILZKYYJQV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |