C25H28N6O3 — CID 66491584
8-(4-butanoylpiperazin-1-yl)-3-methyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione (PubChem CID 66491584) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is 8-(4-butanoylpiperazin-1-yl)-3-methyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione.
| Compound Name | 8-(4-butanoylpiperazin-1-yl)-3-methyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 66491584 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 8-(4-butanoylpiperazin-1-yl)-3-methyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione |
| SMILES | CCCC(=O)N1CCN(c2nc3c(c(=O)[nH]c(=O)n3C)n2Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C25H28N6O3/c1-3-7-20(32)29-12-14-30(15-13-29)24-26-22-21(23(33)27-25(34)28(22)2)31(24)16-18-10-6-9-17-8-4-5-11-19(17)18/h4-6,8-11H,3,7,12-16H2,1-2H3,(H,27,33,34) |
| InChIKey | XECBFTNXCDYURH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |