C17H26N6O4 — CID 66485634
7-(2-ethoxyethyl)-3-methyl-8-(4-propanoylpiperazin-1-yl)purine-2,6-dione (PubChem CID 66485634) has the molecular formula C17H26N6O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 7-(2-ethoxyethyl)-3-methyl-8-(4-propanoylpiperazin-1-yl)purine-2,6-dione.
| Compound Name | 7-(2-ethoxyethyl)-3-methyl-8-(4-propanoylpiperazin-1-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 66485634 |
| Molecular Formula | C17H26N6O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 7-(2-ethoxyethyl)-3-methyl-8-(4-propanoylpiperazin-1-yl)purine-2,6-dione |
| SMILES | CCOCCn1c(N2CCN(C(=O)CC)CC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C17H26N6O4/c1-4-12(24)21-6-8-22(9-7-21)16-18-14-13(23(16)10-11-27-5-2)15(25)19-17(26)20(14)3/h4-11H2,1-3H3,(H,19,25,26) |
| InChIKey | HFZDZDRDKHUYAX-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|