C15H22ClN5O3 — CID 1102620
8-(azepan-1-yl)-7-[(2R)-3-chloro-2-hydroxypropyl]-3-methylpurine-2,6-dione (PubChem CID 1102620) has the molecular formula C15H22ClN5O3 and a molecular weight of 355.83 g/mol. Its IUPAC name is 8-(azepan-1-yl)-7-[(2R)-3-chloro-2-hydroxypropyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(azepan-1-yl)-7-[(2R)-3-chloro-2-hydroxypropyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 1102620 |
| Molecular Formula | C15H22ClN5O3 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 8-(azepan-1-yl)-7-[(2R)-3-chloro-2-hydroxypropyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCCCCC1)n2C[C@@H](O)CCl |
| InChI | InChI=1S/C15H22ClN5O3/c1-19-12-11(13(23)18-15(19)24)21(9-10(22)8-16)14(17-12)20-6-4-2-3-5-7-20/h10,22H,2-9H2,1H3,(H,18,23,24)/t10-/m0/s1 |
| InChIKey | XIEMLDLMLSWKFB-JTQLQIEISA-N |
| XLogP | 0.40 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|