C20H24IN5O4 — CID 3104090
7-[2-hydroxy-3-(4-iodophenoxy)propyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione (PubChem CID 3104090) has the molecular formula C20H24IN5O4 and a molecular weight of 525.35 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(4-iodophenoxy)propyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-(4-iodophenoxy)propyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 3104090 |
| Molecular Formula | C20H24IN5O4 |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 7-[2-hydroxy-3-(4-iodophenoxy)propyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCCCC1)n2CC(O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C20H24IN5O4/c1-24-17-16(18(28)23-20(24)29)26(19(22-17)25-9-3-2-4-10-25)11-14(27)12-30-15-7-5-13(21)6-8-15/h5-8,14,27H,2-4,9-12H2,1H3,(H,23,28,29) |
| InChIKey | BCIHRYHLTRORNG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|