C23H31N5O4 — CID 16805148
8-(azepan-1-yl)-7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione (PubChem CID 16805148) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is 8-(azepan-1-yl)-7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(azepan-1-yl)-7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 16805148 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 8-(azepan-1-yl)-7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione |
| SMILES | CCc1cccc(OCC(O)Cn2c(N3CCCCCC3)nc3c2c(=O)[nH]c(=O)n3C)c1 |
| InChI | InChI=1S/C23H31N5O4/c1-3-16-9-8-10-18(13-16)32-15-17(29)14-28-19-20(26(2)23(31)25-21(19)30)24-22(28)27-11-6-4-5-7-12-27/h8-10,13,17,29H,3-7,11-12,14-15H2,1-2H3,(H,25,30,31) |
| InChIKey | AVURKLXJPPRVKU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |