C18H22ClN7O5 — CID 3064732
7-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-methyl-8-piperazin-1-ylpurine-2,6-dione;hydrochloride (PubChem CID 3064732) has the molecular formula C18H22ClN7O5 and a molecular weight of 451.87 g/mol. Its IUPAC name is 7-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-methyl-8-piperazin-1-ylpurine-2,6-dione;hydrochloride.
| Compound Name | 7-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-methyl-8-piperazin-1-ylpurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 3064732 |
| Molecular Formula | C18H22ClN7O5 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 7-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-methyl-8-piperazin-1-ylpurine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)[nH]c(=O)c2c1nc(N1CCNCC1)n2CC(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H21N7O5.ClH/c1-22-15-14(16(27)21-18(22)28)24(17(20-15)23-8-6-19-7-9-23)10-13(26)11-2-4-12(5-3-11)25(29)30;/h2-5,13,19,26H,6-10H2,1H3,(H,21,27,28);1H |
| InChIKey | DNBQWGZXRRPRFX-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 151.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|