C14H13BrN4O2 — CID 170467102
8-(4-bromobut-1-ynyl)-7-but-2-ynyl-3-methylpurine-2,6-dione (PubChem CID 170467102) has the molecular formula C14H13BrN4O2 and a molecular weight of 349.19 g/mol. Its IUPAC name is 8-(4-bromobut-1-ynyl)-7-but-2-ynyl-3-methylpurine-2,6-dione.
| Compound Name | 8-(4-bromobut-1-ynyl)-7-but-2-ynyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 170467102 |
| Molecular Formula | C14H13BrN4O2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 8-(4-bromobut-1-ynyl)-7-but-2-ynyl-3-methylpurine-2,6-dione |
| SMILES | CC#CCn1c(C#CCCBr)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H13BrN4O2/c1-3-4-9-19-10(7-5-6-8-15)16-12-11(19)13(20)17-14(21)18(12)2/h6,8-9H2,1-2H3,(H,17,20,21) |
| InChIKey | PMACHVFZAWMREB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|