C16H16N4O4 — CID 170472275
ethyl 4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)but-3-ynoate (PubChem CID 170472275) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is ethyl 4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)but-3-ynoate.
| Compound Name | ethyl 4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)but-3-ynoate |
|---|---|
| PubChem CID | 170472275 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | ethyl 4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)but-3-ynoate |
| SMILES | CC#CCn1c(C#CCC(=O)OCC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C16H16N4O4/c1-4-6-10-20-11(8-7-9-12(21)24-5-2)17-14-13(20)15(22)18-16(23)19(14)3/h5,9-10H2,1-3H3,(H,18,22,23) |
| InChIKey | IGYULHQJIQWSEF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|