C14H14N4O3 — CID 170482856
4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)but-3-enal (PubChem CID 170482856) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)but-3-enal.
| Compound Name | 4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)but-3-enal |
|---|---|
| PubChem CID | 170482856 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)but-3-enal |
| SMILES | CC#CCn1c(C=CCC=O)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H14N4O3/c1-3-4-8-18-10(7-5-6-9-19)15-12-11(18)13(20)16-14(21)17(12)2/h5,7,9H,6,8H2,1-2H3,(H,16,20,21) |
| InChIKey | ARNZTKUIUSRXLY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|