C15H15N5O2 — CID 71946934
8-amino-3-methyl-7-(3-phenylprop-2-enyl)purine-2,6-dione (PubChem CID 71946934) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 8-amino-3-methyl-7-(3-phenylprop-2-enyl)purine-2,6-dione.
| Compound Name | 8-amino-3-methyl-7-(3-phenylprop-2-enyl)purine-2,6-dione |
|---|---|
| PubChem CID | 71946934 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 8-amino-3-methyl-7-(3-phenylprop-2-enyl)purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N)n2CC=Cc1ccccc1 |
| InChI | InChI=1S/C15H15N5O2/c1-19-12-11(13(21)18-15(19)22)20(14(16)17-12)9-5-8-10-6-3-2-4-7-10/h2-8H,9H2,1H3,(H2,16,17)(H,18,21,22) |
| InChIKey | LSRKWMPZFNIYDA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |