C13H12ClN5O2 — CID 66485201
8-amino-7-[(3-chlorophenyl)methyl]-3-methylpurine-2,6-dione (PubChem CID 66485201) has the molecular formula C13H12ClN5O2 and a molecular weight of 305.73 g/mol. Its IUPAC name is 8-amino-7-[(3-chlorophenyl)methyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-amino-7-[(3-chlorophenyl)methyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 66485201 |
| Molecular Formula | C13H12ClN5O2 |
| Molecular Weight | 305.73 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 8-amino-7-[(3-chlorophenyl)methyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N)n2Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H12ClN5O2/c1-18-10-9(11(20)17-13(18)21)19(12(15)16-10)6-7-3-2-4-8(14)5-7/h2-5H,6H2,1H3,(H2,15,16)(H,17,20,21) |
| InChIKey | JOHACSQLXGWPIG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.73 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |