C15H12ClN4O4S- — CID 7008980
2-[7-[(3-chlorophenyl)methyl]-3-methyl-2,6-dioxopurin-8-yl]sulfanylacetate (PubChem CID 7008980) has the molecular formula C15H12ClN4O4S- and a molecular weight of 379.81 g/mol. Its IUPAC name is 2-[7-[(3-chlorophenyl)methyl]-3-methyl-2,6-dioxopurin-8-yl]sulfanylacetate.
| Compound Name | 2-[7-[(3-chlorophenyl)methyl]-3-methyl-2,6-dioxopurin-8-yl]sulfanylacetate |
|---|---|
| PubChem CID | 7008980 |
| Molecular Formula | C15H12ClN4O4S- |
| Molecular Weight | 379.81 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2-[7-[(3-chlorophenyl)methyl]-3-methyl-2,6-dioxopurin-8-yl]sulfanylacetate |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(SCC(=O)[O-])n2Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClN4O4S/c1-19-12-11(13(23)18-14(19)24)20(15(17-12)25-7-10(21)22)6-8-3-2-4-9(16)5-8/h2-5H,6-7H2,1H3,(H,21,22)(H,18,23,24)/p-1 |
| InChIKey | GPNGDQWALHECOS-UHFFFAOYSA-M |
| XLogP | -0.03 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.81 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |