C16H15N4O4S- — CID 4292806
2-[3-methyl-2,6-dioxo-7-(2-phenylethyl)purin-8-yl]sulfanylacetate (PubChem CID 4292806) has the molecular formula C16H15N4O4S- and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-[3-methyl-2,6-dioxo-7-(2-phenylethyl)purin-8-yl]sulfanylacetate.
| Compound Name | 2-[3-methyl-2,6-dioxo-7-(2-phenylethyl)purin-8-yl]sulfanylacetate |
|---|---|
| PubChem CID | 4292806 |
| Molecular Formula | C16H15N4O4S- |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-[3-methyl-2,6-dioxo-7-(2-phenylethyl)purin-8-yl]sulfanylacetate |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(SCC(=O)[O-])n2CCc1ccccc1 |
| InChI | InChI=1S/C16H16N4O4S/c1-19-13-12(14(23)18-15(19)24)20(16(17-13)25-9-11(21)22)8-7-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,21,22)(H,18,23,24)/p-1 |
| InChIKey | CBEAHRIXZQTTPK-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |