C17H19ClN4O3S — CID 3117104
8-(3-chloro-2-hydroxypropyl)sulfanyl-3-methyl-7-(2-phenylethyl)purine-2,6-dione (PubChem CID 3117104) has the molecular formula C17H19ClN4O3S and a molecular weight of 394.88 g/mol. Its IUPAC name is 8-(3-chloro-2-hydroxypropyl)sulfanyl-3-methyl-7-(2-phenylethyl)purine-2,6-dione.
| Compound Name | 8-(3-chloro-2-hydroxypropyl)sulfanyl-3-methyl-7-(2-phenylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 3117104 |
| Molecular Formula | C17H19ClN4O3S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 8-(3-chloro-2-hydroxypropyl)sulfanyl-3-methyl-7-(2-phenylethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(SCC(O)CCl)n2CCc1ccccc1 |
| InChI | InChI=1S/C17H19ClN4O3S/c1-21-14-13(15(24)20-16(21)25)22(8-7-11-5-3-2-4-6-11)17(19-14)26-10-12(23)9-18/h2-6,12,23H,7-10H2,1H3,(H,20,24,25) |
| InChIKey | HSUGFIRYTRKMCH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|