C22H21ClN4O4S — CID 3799192
8-benzylsulfanyl-7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione (PubChem CID 3799192) has the molecular formula C22H21ClN4O4S and a molecular weight of 472.95 g/mol. Its IUPAC name is 8-benzylsulfanyl-7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-benzylsulfanyl-7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3799192 |
| Molecular Formula | C22H21ClN4O4S |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 8-benzylsulfanyl-7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(SCc1ccccc1)n2CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN4O4S/c1-26-19-18(20(29)25-21(26)30)27(22(24-19)32-13-14-5-3-2-4-6-14)11-16(28)12-31-17-9-7-15(23)8-10-17/h2-10,16,28H,11-13H2,1H3,(H,25,29,30) |
| InChIKey | BEHVGLOOQSGRTE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |