C23H23ClN4O5 — CID 119056763
7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-8-(3-ethylphenoxy)-3-methylpurine-2,6-dione (PubChem CID 119056763) has the molecular formula C23H23ClN4O5 and a molecular weight of 470.91 g/mol. Its IUPAC name is 7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-8-(3-ethylphenoxy)-3-methylpurine-2,6-dione.
| Compound Name | 7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-8-(3-ethylphenoxy)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 119056763 |
| Molecular Formula | C23H23ClN4O5 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-8-(3-ethylphenoxy)-3-methylpurine-2,6-dione |
| SMILES | CCc1cccc(Oc2nc3c(c(=O)[nH]c(=O)n3C)n2CC(O)COc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H23ClN4O5/c1-3-14-5-4-6-18(11-14)33-23-25-20-19(21(30)26-22(31)27(20)2)28(23)12-16(29)13-32-17-9-7-15(24)8-10-17/h4-11,16,29H,3,12-13H2,1-2H3,(H,26,30,31) |
| InChIKey | ZIKOLMIWUQSQPV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |