C22H22N4O5 — CID 91901256
7-(2-hydroxy-3-phenoxypropyl)-3-methyl-8-(3-methylphenoxy)purine-2,6-dione (PubChem CID 91901256) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 7-(2-hydroxy-3-phenoxypropyl)-3-methyl-8-(3-methylphenoxy)purine-2,6-dione.
| Compound Name | 7-(2-hydroxy-3-phenoxypropyl)-3-methyl-8-(3-methylphenoxy)purine-2,6-dione |
|---|---|
| PubChem CID | 91901256 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 7-(2-hydroxy-3-phenoxypropyl)-3-methyl-8-(3-methylphenoxy)purine-2,6-dione |
| SMILES | Cc1cccc(Oc2nc3c(c(=O)[nH]c(=O)n3C)n2CC(O)COc2ccccc2)c1 |
| InChI | InChI=1S/C22H22N4O5/c1-14-7-6-10-17(11-14)31-22-23-19-18(20(28)24-21(29)25(19)2)26(22)12-15(27)13-30-16-8-4-3-5-9-16/h3-11,15,27H,12-13H2,1-2H3,(H,24,28,29) |
| InChIKey | KTEZBDQVCMZNMA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |