C23H22N4O6 — CID 91901280
[7-[2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-2,6-dioxopurin-8-yl] benzoate (PubChem CID 91901280) has the molecular formula C23H22N4O6 and a molecular weight of 450.45 g/mol. Its IUPAC name is [7-[2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-2,6-dioxopurin-8-yl] benzoate.
| Compound Name | [7-[2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-2,6-dioxopurin-8-yl] benzoate |
|---|---|
| PubChem CID | 91901280 |
| Molecular Formula | C23H22N4O6 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | [7-[2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-2,6-dioxopurin-8-yl] benzoate |
| SMILES | Cc1ccc(OCC(O)Cn2c(OC(=O)c3ccccc3)nc3c2c(=O)[nH]c(=O)n3C)cc1 |
| InChI | InChI=1S/C23H22N4O6/c1-14-8-10-17(11-9-14)32-13-16(28)12-27-18-19(26(2)22(31)25-20(18)29)24-23(27)33-21(30)15-6-4-3-5-7-15/h3-11,16,28H,12-13H2,1-2H3,(H,25,29,31) |
| InChIKey | KAPDSQNZRAPQJU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |