C24H23N7O5 — CID 136915623
8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methylpurine-2,6-dione (PubChem CID 136915623) has the molecular formula C24H23N7O5 and a molecular weight of 489.49 g/mol. Its IUPAC name is 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 136915623 |
| Molecular Formula | C24H23N7O5 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
| SMILES | Cc1ccc(OC[C@H](O)Cn2c(/N=N/c3c(O)[nH]c4ccccc34)nc3c2c(=O)[nH]c(=O)n3C)cc1 |
| InChI | InChI=1S/C24H23N7O5/c1-13-7-9-15(10-8-13)36-12-14(32)11-31-19-20(30(2)24(35)27-22(19)34)26-23(31)29-28-18-16-5-3-4-6-17(16)25-21(18)33/h3-10,14,25,32-33H,11-12H2,1-2H3,(H,27,34,35)/b29-28+/t14-/m1/s1 |
| InChIKey | FDYZKIFBTAKOJE-AIPIOJKYSA-N |
| XLogP | 2.77 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|