C21H25N7O5 — CID 136793267
8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 136793267) has the molecular formula C21H25N7O5 and a molecular weight of 455.48 g/mol. Its IUPAC name is 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 136793267 |
| Molecular Formula | C21H25N7O5 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CC(C)OC[C@@H](O)Cn1c(/N=N/c2c(O)[nH]c3ccccc23)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C21H25N7O5/c1-11(2)33-10-12(29)9-28-16-17(26(3)21(32)27(4)19(16)31)23-20(28)25-24-15-13-7-5-6-8-14(13)22-18(15)30/h5-8,11-12,22,29-30H,9-10H2,1-4H3/b25-24+/t12-/m0/s1 |
| InChIKey | LWJPWTRFRXGGGG-DESRBJQCSA-N |
| XLogP | 1.82 |
| TPSA | 152.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|