C21H22N8O7 — CID 136755597
8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 136755597) has the molecular formula C21H22N8O7 and a molecular weight of 498.46 g/mol. Its IUPAC name is 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 136755597 |
| Molecular Formula | C21H22N8O7 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cc1cccc(OC[C@H](O)Cn2c(/N=N/c3c(O)[nH]c(=O)[nH]c3=O)nc3c2c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C21H22N8O7/c1-10-5-4-6-12(7-10)36-9-11(30)8-29-14-15(27(2)21(35)28(3)18(14)33)22-19(29)26-25-13-16(31)23-20(34)24-17(13)32/h4-7,11,30H,8-9H2,1-3H3,(H3,23,24,31,32,34)/b26-25+/t11-/m1/s1 |
| InChIKey | KPGJLQUHPTZNQO-JBBLQVIMSA-N |
| XLogP | -0.32 |
| TPSA | 201.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|